C21H30O3 — CID 51417551
(1S,2R,5S,6S,9R,13S,18R)-6-hydroxy-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-one (PubChem CID 51417551) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (1S,2R,5S,6S,9R,13S,18R)-6-hydroxy-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-one.
| Compound Name | (1S,2R,5S,6S,9R,13S,18R)-6-hydroxy-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-one |
|---|---|
| PubChem CID | 51417551 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1S,2R,5S,6S,9R,13S,18R)-6-hydroxy-6,13-dimethyl-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-one |
| SMILES | C[C@]1(O)OC[C@]23CC=C4[C@@H](CC[C@@H]5CC(=O)CC[C@]45C)[C@H]2CC[C@@H]31 |
| InChI | InChI=1S/C21H30O3/c1-19-9-7-14(22)11-13(19)3-4-15-16(19)8-10-21-12-24-20(2,23)18(21)6-5-17(15)21/h8,13,15,17-18,23H,3-7,9-12H2,1-2H3/t13-,15-,17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | JGBMULDFHPMVIA-HCPWEWLASA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|