C13H16N4O4 — CID 51422872
(4aR,8aR)-1-(4-nitro-1H-pyrazole-5-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one (PubChem CID 51422872) has the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is (4aR,8aR)-1-(4-nitro-1H-pyrazole-5-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one.
| Compound Name | (4aR,8aR)-1-(4-nitro-1H-pyrazole-5-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
|---|---|
| PubChem CID | 51422872 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (4aR,8aR)-1-(4-nitro-1H-pyrazole-5-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)c2[nH]ncc2[N+](=O)[O-])[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H16N4O4/c18-11-5-6-16(9-4-2-1-3-8(9)11)13(19)12-10(17(20)21)7-14-15-12/h7-9H,1-6H2,(H,14,15)/t8-,9-/m1/s1 |
| InChIKey | LVPVFWBIIFCUPN-RKDXNWHRSA-N |
| XLogP | 1.29 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|