C20H30N2O3+2 — CID 5142349
2-(3,4-dihydroxyphenyl)-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 5142349) has the molecular formula C20H30N2O3+2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 5142349 |
| Molecular Formula | C20H30N2O3+2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC(C)C12C[NH+]3CC(C(C)C)(C[NH+](C1)C3c1ccc(O)c(O)c1)C2=O |
| InChI | InChI=1S/C20H28N2O3/c1-12(2)19-8-21-10-20(13(3)4,18(19)25)11-22(9-19)17(21)14-5-6-15(23)16(24)7-14/h5-7,12-13,17,23-24H,8-11H2,1-4H3/p+2 |
| InChIKey | QPQJSUNHSFTXRM-UHFFFAOYSA-P |
| XLogP | -0.24 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|