About (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate
(1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate (PubChem CID 51424654) has the molecular formula C7H5O4-
and a molecular weight of 153.11 g/mol. Its IUPAC name is (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate.
Molecular Properties
| Compound Name | (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate |
| PubChem CID | 51424654 |
| Molecular Formula | C7H5O4- |
| Molecular Weight | 153.11 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate |
| SMILES | CC1=C([O-])C(=O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C7H6O4/c1-2-3(8)5(10)7-6(11-7)4(2)9/h6-8H,1H3/p-1/t6-,7+/m1/s1 |
| InChIKey | ATFNSNUJZOYXFC-RQJHMYQMSA-M |
| XLogP | -1.46 |
| TPSA | 69.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.11 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate?
The IUPAC name of (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate (CID 51424654) is (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate.
What is the SMILES notation for (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate?
The canonical SMILES for (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate is CC1=C([O-])C(=O)[C@@H]2O[C@@H]2C1=O.
What is the InChIKey of (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate?
The InChIKey is ATFNSNUJZOYXFC-RQJHMYQMSA-M. The full InChI is InChI=1S/C7H6O4/c1-2-3(8)5(10)7-6(11-7)4(2)9/h6-8H,1H3/p-1/t6-,7+/m1/s1.
What are the key properties of (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate?
(1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate has a molecular weight of 153.11 g/mol, XLogP of -1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-4-methyl-2,5-dioxo-7-oxabicyclo[4.1.0]hept-3-en-3-olate is sourced from PubChem (CID 51424654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).