C31H25N3O2 — CID 5142471
1,1,5,5-tetraphenyl-4-(1,2,4-triazol-1-yl)pent-2-yne-1,5-diol (PubChem CID 5142471) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 1,1,5,5-tetraphenyl-4-(1,2,4-triazol-1-yl)pent-2-yne-1,5-diol.
| Compound Name | 1,1,5,5-tetraphenyl-4-(1,2,4-triazol-1-yl)pent-2-yne-1,5-diol |
|---|---|
| PubChem CID | 5142471 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 1,1,5,5-tetraphenyl-4-(1,2,4-triazol-1-yl)pent-2-yne-1,5-diol |
| SMILES | OC(C#CC(n1cncn1)C(O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H25N3O2/c35-30(25-13-5-1-6-14-25,26-15-7-2-8-16-26)22-21-29(34-24-32-23-33-34)31(36,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,23-24,29,35-36H |
| InChIKey | HLEBLPWUMJJYQA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|