C12H15N5O2S4 — CID 5142568
1-[(3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea (PubChem CID 5142568) has the molecular formula C12H15N5O2S4 and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-[(3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea.
| Compound Name | 1-[(3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 5142568 |
| Molecular Formula | C12H15N5O2S4 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 1-[(3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbonyl)amino]-3-(3,4-dimethyl-2-sulfanylidene-1,3-thiazol-5-yl)urea |
| SMILES | Cc1c(NC(=O)NNC(=O)c2sc(=S)n(C)c2C)sc(=S)n1C |
| InChI | InChI=1S/C12H15N5O2S4/c1-5-7(22-11(20)16(5)3)8(18)14-15-10(19)13-9-6(2)17(4)12(21)23-9/h1-4H3,(H,14,18)(H2,13,15,19) |
| InChIKey | OLLRUJNBGSUGHW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|