About 3,5-dibromopyrazin-2-olate
3,5-dibromopyrazin-2-olate (PubChem CID 51426326) has the molecular formula C4HBr2N2O-
and a molecular weight of 252.87 g/mol. Its IUPAC name is 3,5-dibromopyrazin-2-olate.
Molecular Properties
| Compound Name | 3,5-dibromopyrazin-2-olate |
| PubChem CID | 51426326 |
| Molecular Formula | C4HBr2N2O- |
| Molecular Weight | 252.87 g/mol |
| Exact Mass | 250.85 |
| IUPAC Name | 3,5-dibromopyrazin-2-olate |
| SMILES | [O-]c1ncc(Br)nc1Br |
| InChI | InChI=1S/C4H2Br2N2O/c5-2-1-7-4(9)3(6)8-2/h1H,(H,7,9)/p-1 |
| InChIKey | NHVGHXUOFWEOSN-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 48.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.87 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dibromopyrazin-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromopyrazin-2-olate?
The IUPAC name of 3,5-dibromopyrazin-2-olate (CID 51426326) is 3,5-dibromopyrazin-2-olate.
What is the SMILES notation for 3,5-dibromopyrazin-2-olate?
The canonical SMILES for 3,5-dibromopyrazin-2-olate is [O-]c1ncc(Br)nc1Br.
What is the InChIKey of 3,5-dibromopyrazin-2-olate?
The InChIKey is NHVGHXUOFWEOSN-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H2Br2N2O/c5-2-1-7-4(9)3(6)8-2/h1H,(H,7,9)/p-1.
What are the key properties of 3,5-dibromopyrazin-2-olate?
3,5-dibromopyrazin-2-olate has a molecular weight of 252.87 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromopyrazin-2-olate is sourced from PubChem (CID 51426326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).