C12H17N3OS — CID 51426533
(1R,3S,4S)-4,7,7-trimethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 51426533) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is (1R,3S,4S)-4,7,7-trimethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4S)-4,7,7-trimethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 51426533 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (1R,3S,4S)-4,7,7-trimethyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](Sc1ncn[nH]1)C2=O |
| InChI | InChI=1S/C12H17N3OS/c1-11(2)7-4-5-12(11,3)9(8(7)16)17-10-13-6-14-15-10/h6-7,9H,4-5H2,1-3H3,(H,13,14,15)/t7-,9+,12+/m0/s1 |
| InChIKey | RHCZGHMQRRXSDR-LPBBDHJYSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |