C23H36N2 — CID 51427600
(3S,5R)-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethyladamantan-1-amine (PubChem CID 51427600) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is (3S,5R)-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethyladamantan-1-amine.
| Compound Name | (3S,5R)-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethyladamantan-1-amine |
|---|---|
| PubChem CID | 51427600 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (3S,5R)-N-[[4-(diethylamino)phenyl]methyl]-3,5-dimethyladamantan-1-amine |
| SMILES | CCN(CC)c1ccc(CNC23CC4C[C@@](C)(C2)C[C@](C)(C4)C3)cc1 |
| InChI | InChI=1S/C23H36N2/c1-5-25(6-2)20-9-7-18(8-10-20)14-24-23-13-19-11-21(3,16-23)15-22(4,12-19)17-23/h7-10,19,24H,5-6,11-17H2,1-4H3/t19?,21-,22+,23? |
| InChIKey | CJMXVXYMYBVBPL-UUVJWNOVSA-N |
| XLogP | 5.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|