C31H32N2O6 — CID 5143151
methyl 4-[1-[2-(dimethylamino)ethyl]-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 5143151) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is methyl 4-[1-[2-(dimethylamino)ethyl]-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-[2-(dimethylamino)ethyl]-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 5143151 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | methyl 4-[1-[2-(dimethylamino)ethyl]-3-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2CCN(C)C)cc1 |
| InChI | InChI=1S/C31H32N2O6/c1-20-6-5-7-21(18-20)19-39-25-14-12-23(13-15-25)28(34)26-27(22-8-10-24(11-9-22)31(37)38-4)33(17-16-32(2)3)30(36)29(26)35/h5-15,18,27,34H,16-17,19H2,1-4H3 |
| InChIKey | HYAAEKHBIQXJIB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|