C24H27NO5 — CID 5143313
6-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-3,5-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 5143313) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 6-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-3,5-dimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 6-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-3,5-dimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 5143313 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 6-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-3,5-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1coc2cc3oc(=O)c(CC(=O)N4CCC5(O)CCCCC5C4)c(C)c3cc12 |
| InChI | InChI=1S/C24H27NO5/c1-14-13-29-20-11-21-18(9-17(14)20)15(2)19(23(27)30-21)10-22(26)25-8-7-24(28)6-4-3-5-16(24)12-25/h9,11,13,16,28H,3-8,10,12H2,1-2H3 |
| InChIKey | OBBYMWBLBQQRLE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|