C16H17F2N3O2 — CID 51435092
3-[(Z)-(3,4-difluorophenyl)methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 51435092) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-[(Z)-(3,4-difluorophenyl)methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(Z)-(3,4-difluorophenyl)methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 51435092 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3-[(Z)-(3,4-difluorophenyl)methylideneamino]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(/N=C\c1ccc(F)c(F)c1)C2=O |
| InChI | InChI=1S/C16H17F2N3O2/c1-10-4-6-16(7-5-10)14(22)21(15(23)20-16)19-9-11-2-3-12(17)13(18)8-11/h2-3,8-10H,4-7H2,1H3,(H,20,23)/b19-9- |
| InChIKey | JVRHPERRKGGGOG-OCKHKDLRSA-N |
| XLogP | 2.80 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|