C40H46N2O3 — CID 5143559
[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone (PubChem CID 5143559) has the molecular formula C40H46N2O3 and a molecular weight of 602.82 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone |
|---|---|
| PubChem CID | 5143559 |
| Molecular Formula | C40H46N2O3 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccccc4)=C3)C2CCC2(C)C1CCC2(O)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C40H46N2O3/c1-36-16-12-27(43)22-38(36)19-20-40(30(23-38)35(44)26-8-4-3-5-9-26)33(36)13-17-37(2)34(40)14-18-39(37,45)25-42-21-15-29-28-10-6-7-11-31(28)41-32(29)24-42/h3-11,19-20,23,27,33-34,41,43,45H,12-18,21-22,24-25H2,1-2H3 |
| InChIKey | FOSPWBPHUFTVLB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|