About 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine
2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 5143782) has the molecular formula C15H13ClINO2S2
and a molecular weight of 465.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine |
| PubChem CID | 5143782 |
| Molecular Formula | C15H13ClINO2S2 |
| Molecular Weight | 465.77 g/mol |
| Exact Mass | 464.91 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc(I)cc1)N1CCSC1c1ccccc1Cl |
| InChI | InChI=1S/C15H13ClINO2S2/c16-14-4-2-1-3-13(14)15-18(9-10-21-15)22(19,20)12-7-5-11(17)6-8-12/h1-8,15H,9-10H2 |
| InChIKey | YSMGYQWEPQHKEK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine?
The IUPAC name of 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine (CID 5143782) is 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine.
What is the SMILES notation for 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine?
The canonical SMILES for 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine is O=S(=O)(c1ccc(I)cc1)N1CCSC1c1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine?
The InChIKey is YSMGYQWEPQHKEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClINO2S2/c16-14-4-2-1-3-13(14)15-18(9-10-21-15)22(19,20)12-7-5-11(17)6-8-12/h1-8,15H,9-10H2.
What are the key properties of 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine?
2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine has a molecular weight of 465.77 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine is sourced from PubChem (CID 5143782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).