C31H40N6O6S — CID 514409
N-[(2S,3R)-4-[(2-amino-1,3-benzoxazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-(3,4-diamino-2,6-dimethylphenoxy)acetamide (PubChem CID 514409) has the molecular formula C31H40N6O6S and a molecular weight of 624.76 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(2-amino-1,3-benzoxazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-(3,4-diamino-2,6-dimethylphenoxy)acetamide.
| Compound Name | N-[(2S,3R)-4-[(2-amino-1,3-benzoxazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-(3,4-diamino-2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 514409 |
| Molecular Formula | C31H40N6O6S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | N-[(2S,3R)-4-[(2-amino-1,3-benzoxazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-(3,4-diamino-2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(N)c(N)c(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc2nc(N)oc2c1 |
| InChI | InChI=1S/C31H40N6O6S/c1-18(2)15-37(44(40,41)22-10-11-24-27(14-22)43-31(34)36-24)16-26(38)25(13-21-8-6-5-7-9-21)35-28(39)17-42-30-19(3)12-23(32)29(33)20(30)4/h5-12,14,18,25-26,38H,13,15-17,32-33H2,1-4H3,(H2,34,36)(H,35,39)/t25-,26+/m0/s1 |
| InChIKey | KEBMVZOQMZTSOW-IZZNHLLZSA-N |
| XLogP | 3.01 |
| TPSA | 200.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|