C15H11Cl2FN2O — CID 51441524
(3R)-3-amino-1-[(3,4-dichlorophenyl)methyl]-5-fluoro-3H-indol-2-one (PubChem CID 51441524) has the molecular formula C15H11Cl2FN2O and a molecular weight of 325.17 g/mol. Its IUPAC name is (3R)-3-amino-1-[(3,4-dichlorophenyl)methyl]-5-fluoro-3H-indol-2-one.
| Compound Name | (3R)-3-amino-1-[(3,4-dichlorophenyl)methyl]-5-fluoro-3H-indol-2-one |
|---|---|
| PubChem CID | 51441524 |
| Molecular Formula | C15H11Cl2FN2O |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (3R)-3-amino-1-[(3,4-dichlorophenyl)methyl]-5-fluoro-3H-indol-2-one |
| SMILES | N[C@H]1C(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C15H11Cl2FN2O/c16-11-3-1-8(5-12(11)17)7-20-13-4-2-9(18)6-10(13)14(19)15(20)21/h1-6,14H,7,19H2/t14-/m1/s1 |
| InChIKey | LYEKXSSHKAJMOF-CQSZACIVSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |