C10H11Cl2N — CID 51441576
(1S)-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 51441576) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is (1S)-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 51441576 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (1S)-5,7-dichloro-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@H]1CCCc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C10H11Cl2N/c11-6-4-8-7(9(12)5-6)2-1-3-10(8)13/h4-5,10H,1-3,13H2/t10-/m0/s1 |
| InChIKey | ZDKDCHIVZVZNMV-JTQLQIEISA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |