C16H16N4O4 — CID 51443837
diethyl (3S)-5-amino-4,4,6-tricyano-3-methylcyclohexa-1,5-diene-1,3-dicarboxylate (PubChem CID 51443837) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is diethyl (3S)-5-amino-4,4,6-tricyano-3-methylcyclohexa-1,5-diene-1,3-dicarboxylate.
| Compound Name | diethyl (3S)-5-amino-4,4,6-tricyano-3-methylcyclohexa-1,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 51443837 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | diethyl (3S)-5-amino-4,4,6-tricyano-3-methylcyclohexa-1,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C[C@](C)(C(=O)OCC)C(C#N)(C#N)C(N)=C1C#N |
| InChI | InChI=1S/C16H16N4O4/c1-4-23-13(21)10-6-15(3,14(22)24-5-2)16(8-18,9-19)12(20)11(10)7-17/h6H,4-5,20H2,1-3H3/t15-/m1/s1 |
| InChIKey | LZFOTFMRZAPMFY-OAHLLOKOSA-N |
| XLogP | 0.83 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|