C24H33NO9 — CID 51444310
2-[4,8-dimethyl-7-(2-methylprop-2-enoxy)-2-oxochromen-3-yl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide (PubChem CID 51444310) has the molecular formula C24H33NO9 and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-[4,8-dimethyl-7-(2-methylprop-2-enoxy)-2-oxochromen-3-yl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide.
| Compound Name | 2-[4,8-dimethyl-7-(2-methylprop-2-enoxy)-2-oxochromen-3-yl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide |
|---|---|
| PubChem CID | 51444310 |
| Molecular Formula | C24H33NO9 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[4,8-dimethyl-7-(2-methylprop-2-enoxy)-2-oxochromen-3-yl]-N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]acetamide |
| SMILES | C=C(C)COc1ccc2c(C)c(CC(=O)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c(=O)oc2c1C |
| InChI | InChI=1S/C24H33NO9/c1-12(2)11-33-19-7-6-15-13(3)16(24(32)34-23(15)14(19)4)8-20(29)25(5)9-17(27)21(30)22(31)18(28)10-26/h6-7,17-18,21-22,26-28,30-31H,1,8-11H2,2-5H3/t17-,18+,21+,22+/m0/s1 |
| InChIKey | VWPZXYQDJRNVHF-XHIHJMKYSA-N |
| XLogP | -0.20 |
| TPSA | 160.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|