C29H23N3O6 — CID 51444444
methyl 2-[(1S,11R,12S,16S)-11-(4-methoxybenzoyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate (PubChem CID 51444444) has the molecular formula C29H23N3O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is methyl 2-[(1S,11R,12S,16S)-11-(4-methoxybenzoyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate.
| Compound Name | methyl 2-[(1S,11R,12S,16S)-11-(4-methoxybenzoyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate |
|---|---|
| PubChem CID | 51444444 |
| Molecular Formula | C29H23N3O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | methyl 2-[(1S,11R,12S,16S)-11-(4-methoxybenzoyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraen-14-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@H]2[C@H](C1=O)[C@H](C(=O)c1ccc(OC)cc1)N1N=Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C29H23N3O6/c1-37-18-13-11-16(12-14-18)26(33)25-23-22(24-19-8-4-3-7-17(19)15-30-32(24)25)27(34)31(28(23)35)21-10-6-5-9-20(21)29(36)38-2/h3-15,22-25H,1-2H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | AANUQHGLJCTRSU-CXSMSNRLSA-N |
| XLogP | 3.24 |
| TPSA | 105.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|