About bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate
bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate (PubChem CID 5145674) has the molecular formula C17H19N3O6
and a molecular weight of 361.35 g/mol. Its IUPAC name is bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| PubChem CID | 5145674 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate |
| SMILES | O=C(COC(=O)c1cccc(C(=O)OCC(=O)NC2CC2)n1)NC1CC1 |
| InChI | InChI=1S/C17H19N3O6/c21-14(18-10-4-5-10)8-25-16(23)12-2-1-3-13(20-12)17(24)26-9-15(22)19-11-6-7-11/h1-3,10-11H,4-9H2,(H,18,21)(H,19,22) |
| InChIKey | JQSWFBXEZMEKJA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
The IUPAC name of bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate (CID 5145674) is bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate.
What is the SMILES notation for bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
The canonical SMILES for bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate is O=C(COC(=O)c1cccc(C(=O)OCC(=O)NC2CC2)n1)NC1CC1.
What is the InChIKey of bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
The InChIKey is JQSWFBXEZMEKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O6/c21-14(18-10-4-5-10)8-25-16(23)12-2-1-3-13(20-12)17(24)26-9-15(22)19-11-6-7-11/h1-3,10-11H,4-9H2,(H,18,21)(H,19,22).
What are the key properties of bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate?
bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate has a molecular weight of 361.35 g/mol, XLogP of -0.05, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(cyclopropylamino)-2-oxoethyl] pyridine-2,6-dicarboxylate is sourced from PubChem (CID 5145674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).