C29H26ClN3O4 — CID 51458589
(6S)-5-[2-(4-chlorophenyl)acetyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 51458589) has the molecular formula C29H26ClN3O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is (6S)-5-[2-(4-chlorophenyl)acetyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S)-5-[2-(4-chlorophenyl)acetyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 51458589 |
| Molecular Formula | C29H26ClN3O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | (6S)-5-[2-(4-chlorophenyl)acetyl]-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(C(=O)Cc1ccc(Cl)cc1)[C@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H26ClN3O4/c1-29(2)16-23-27(25(34)17-29)28(19-9-13-21(14-10-19)33(36)37)32(24-6-4-3-5-22(24)31-23)26(35)15-18-7-11-20(30)12-8-18/h3-14,28,31H,15-17H2,1-2H3/t28-/m0/s1 |
| InChIKey | MGHDMBCUSLJKNJ-NDEPHWFRSA-N |
| XLogP | 6.63 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|