C28H32N4Si2 — CID 5146133
3,3,6,6-tetramethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane (PubChem CID 5146133) has the molecular formula C28H32N4Si2 and a molecular weight of 480.76 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane.
| Compound Name | 3,3,6,6-tetramethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane |
|---|---|
| PubChem CID | 5146133 |
| Molecular Formula | C28H32N4Si2 |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3,3,6,6-tetramethyl-1,2,4,5-tetraphenyl-1,2,4,5,3,6-tetrazadisilinane |
| SMILES | C[Si]1(C)N(c2ccccc2)N(c2ccccc2)[Si](C)(C)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C28H32N4Si2/c1-33(2)29(25-17-9-5-10-18-25)31(27-21-13-7-14-22-27)34(3,4)32(28-23-15-8-16-24-28)30(33)26-19-11-6-12-20-26/h5-24H,1-4H3 |
| InChIKey | DWERHZSENAPLOR-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|