C17H13Cl2N3 — CID 5146621
1-(3,4-dichlorophenyl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine (PubChem CID 5146621) has the molecular formula C17H13Cl2N3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine |
|---|---|
| PubChem CID | 5146621 |
| Molecular Formula | C17H13Cl2N3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine |
| SMILES | Nc1c2c(nc3ccccc13)N(c1ccc(Cl)c(Cl)c1)CC2 |
| InChI | InChI=1S/C17H13Cl2N3/c18-13-6-5-10(9-14(13)19)22-8-7-12-16(20)11-3-1-2-4-15(11)21-17(12)22/h1-6,9H,7-8H2,(H2,20,21) |
| InChIKey | SOMPZWPMMFOZCE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |