C19H14F3N5O3 — CID 51467278
2-[(3aS,6aR)-5-(3,4-difluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 51467278) has the molecular formula C19H14F3N5O3 and a molecular weight of 417.35 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-(3,4-difluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(3-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-[(3aS,6aR)-5-(3,4-difluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(3-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 51467278 |
| Molecular Formula | C19H14F3N5O3 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-[(3aS,6aR)-5-(3,4-difluorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]-N-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2N=N[C@H]3C(=O)N(c4ccc(F)c(F)c4)C(=O)[C@H]32)cc1F |
| InChI | InChI=1S/C19H14F3N5O3/c1-9-2-3-10(6-13(9)21)23-15(28)8-26-17-16(24-25-26)18(29)27(19(17)30)11-4-5-12(20)14(22)7-11/h2-7,16-17H,8H2,1H3,(H,23,28)/t16-,17+/m1/s1 |
| InChIKey | IOYFDTFIIJHGHW-SJORKVTESA-N |
| XLogP | 2.34 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|