C24H19ClN2O2 — CID 5147036
4-[4-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoic acid (PubChem CID 5147036) has the molecular formula C24H19ClN2O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoic acid.
| Compound Name | 4-[4-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 5147036 |
| Molecular Formula | C24H19ClN2O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 4-[4-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2NCC(c3ccccc3Cl)c3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C24H19ClN2O2/c25-19-7-3-1-5-16(19)18-13-26-22(14-9-11-15(12-10-14)24(28)29)23-21(18)17-6-2-4-8-20(17)27-23/h1-12,18,22,26-27H,13H2,(H,28,29) |
| InChIKey | XEPVZMXQAWUWOU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|