C23H24N2O7 — CID 51471334
(1S,3S,3aR,6aR)-1-(3-ethoxy-2-hydroxyphenyl)-5-(2-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 51471334) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is (1S,3S,3aR,6aR)-1-(3-ethoxy-2-hydroxyphenyl)-5-(2-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1S,3S,3aR,6aR)-1-(3-ethoxy-2-hydroxyphenyl)-5-(2-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 51471334 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (1S,3S,3aR,6aR)-1-(3-ethoxy-2-hydroxyphenyl)-5-(2-methoxyphenyl)-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCOc1cccc([C@H]2N[C@](C)(C(=O)O)[C@@H]3C(=O)N(c4ccccc4OC)C(=O)[C@@H]23)c1O |
| InChI | InChI=1S/C23H24N2O7/c1-4-32-15-11-7-8-12(19(15)26)18-16-17(23(2,24-18)22(29)30)21(28)25(20(16)27)13-9-5-6-10-14(13)31-3/h5-11,16-18,24,26H,4H2,1-3H3,(H,29,30)/t16-,17+,18-,23+/m1/s1 |
| InChIKey | ZELOXWZXUZMIEU-MIVHDCIWSA-N |
| XLogP | 2.09 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|