C24H24N2O3 — CID 5147150
(4R,5S)-2,4,5-tris(4-methoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 5147150) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (4R,5S)-2,4,5-tris(4-methoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2,4,5-tris(4-methoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 5147150 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (4R,5S)-2,4,5-tris(4-methoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(C2=N[C@H](c3ccc(OC)cc3)[C@H](c3ccc(OC)cc3)N2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-27-19-10-4-16(5-11-19)22-23(17-6-12-20(28-2)13-7-17)26-24(25-22)18-8-14-21(29-3)15-9-18/h4-15,22-23H,1-3H3,(H,25,26)/t22-,23+ |
| InChIKey | COFINZKQFSLCKX-ZRZAMGCNSA-N |
| XLogP | 4.54 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |