About 3-indazol-1-ylpropanoate
3-indazol-1-ylpropanoate (PubChem CID 5147223) has the molecular formula C10H9N2O2-
and a molecular weight of 189.19 g/mol. Its IUPAC name is 3-indazol-1-ylpropanoate.
Molecular Properties
| Compound Name | 3-indazol-1-ylpropanoate |
| PubChem CID | 5147223 |
| Molecular Formula | C10H9N2O2- |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-indazol-1-ylpropanoate |
| SMILES | O=C([O-])CCn1ncc2ccccc21 |
| InChI | InChI=1S/C10H10N2O2/c13-10(14)5-6-12-9-4-2-1-3-8(9)7-11-12/h1-4,7H,5-6H2,(H,13,14)/p-1 |
| InChIKey | KWLUWAKLSFDQNN-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-indazol-1-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-indazol-1-ylpropanoate?
The IUPAC name of 3-indazol-1-ylpropanoate (CID 5147223) is 3-indazol-1-ylpropanoate.
What is the SMILES notation for 3-indazol-1-ylpropanoate?
The canonical SMILES for 3-indazol-1-ylpropanoate is O=C([O-])CCn1ncc2ccccc21.
What is the InChIKey of 3-indazol-1-ylpropanoate?
The InChIKey is KWLUWAKLSFDQNN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10N2O2/c13-10(14)5-6-12-9-4-2-1-3-8(9)7-11-12/h1-4,7H,5-6H2,(H,13,14)/p-1.
What are the key properties of 3-indazol-1-ylpropanoate?
3-indazol-1-ylpropanoate has a molecular weight of 189.19 g/mol, XLogP of 0.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-indazol-1-ylpropanoate is sourced from PubChem (CID 5147223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).