About 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid
2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid (PubChem CID 5147257) has the molecular formula C5H7NO3S
and a molecular weight of 161.18 g/mol. Its IUPAC name is 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid |
| PubChem CID | 5147257 |
| Molecular Formula | C5H7NO3S |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid |
| SMILES | O=C(O)CN1CSCC1=O |
| InChI | InChI=1S/C5H7NO3S/c7-4-2-10-3-6(4)1-5(8)9/h1-3H2,(H,8,9) |
| InChIKey | HZPPUQAAZNDUAL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid?
The IUPAC name of 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid (CID 5147257) is 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid is O=C(O)CN1CSCC1=O.
What is the InChIKey of 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid?
The InChIKey is HZPPUQAAZNDUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3S/c7-4-2-10-3-6(4)1-5(8)9/h1-3H2,(H,8,9).
What are the key properties of 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid?
2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid has a molecular weight of 161.18 g/mol, XLogP of -0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxo-1,3-thiazolidin-3-yl)acetic acid is sourced from PubChem (CID 5147257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).