C19H26N2O3S — CID 51473315
[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanone (PubChem CID 51473315) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanone.
| Compound Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 51473315 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(N2CCCS2(=O)=O)c1)N1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H26N2O3S/c22-19(20-11-4-8-15-6-1-2-10-18(15)20)16-7-3-9-17(14-16)21-12-5-13-25(21,23)24/h3,7,9,14-15,18H,1-2,4-6,8,10-13H2/t15-,18+/m1/s1 |
| InChIKey | NKFVBQBNEWSKLX-QAPCUYQASA-N |
| XLogP | 3.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |