C21H24N4S — CID 51474218
(3R)-3-(1H-benzimidazol-2-yl)-N-(2-phenylethyl)piperidine-1-carbothioamide (PubChem CID 51474218) has the molecular formula C21H24N4S and a molecular weight of 364.52 g/mol. Its IUPAC name is (3R)-3-(1H-benzimidazol-2-yl)-N-(2-phenylethyl)piperidine-1-carbothioamide.
| Compound Name | (3R)-3-(1H-benzimidazol-2-yl)-N-(2-phenylethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 51474218 |
| Molecular Formula | C21H24N4S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (3R)-3-(1H-benzimidazol-2-yl)-N-(2-phenylethyl)piperidine-1-carbothioamide |
| SMILES | S=C(NCCc1ccccc1)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C21H24N4S/c26-21(22-13-12-16-7-2-1-3-8-16)25-14-6-9-17(15-25)20-23-18-10-4-5-11-19(18)24-20/h1-5,7-8,10-11,17H,6,9,12-15H2,(H,22,26)(H,23,24)/t17-/m1/s1 |
| InChIKey | OCOJEHZYKTTWKD-QGZVFWFLSA-N |
| XLogP | 3.86 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|