C8H5F7N2OS — CID 5147697
2,2,3,3,4,4,4-heptafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 5147697) has the molecular formula C8H5F7N2OS and a molecular weight of 310.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 5147697 |
| Molecular Formula | C8H5F7N2OS |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1cnc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C8H5F7N2OS/c1-3-2-16-5(19-3)17-4(18)6(9,10)7(11,12)8(13,14)15/h2H,1H3,(H,16,17,18) |
| InChIKey | OOHAWWUPDKTXDV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|