About 1,4,5,8-tetramethylanthracene
1,4,5,8-tetramethylanthracene (PubChem CID 5147927) has the molecular formula C18H18
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1,4,5,8-tetramethylanthracene.
Molecular Properties
| Compound Name | 1,4,5,8-tetramethylanthracene |
| PubChem CID | 5147927 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1,4,5,8-tetramethylanthracene |
| SMILES | Cc1ccc(C)c2cc3c(C)ccc(C)c3cc12 |
| InChI | InChI=1S/C18H18/c1-11-5-6-12(2)16-10-18-14(4)8-7-13(3)17(18)9-15(11)16/h5-10H,1-4H3 |
| InChIKey | OCFNRIXVFFNDKR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4,5,8-tetramethylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5,8-tetramethylanthracene?
The IUPAC name of 1,4,5,8-tetramethylanthracene (CID 5147927) is 1,4,5,8-tetramethylanthracene.
What is the SMILES notation for 1,4,5,8-tetramethylanthracene?
The canonical SMILES for 1,4,5,8-tetramethylanthracene is Cc1ccc(C)c2cc3c(C)ccc(C)c3cc12.
What is the InChIKey of 1,4,5,8-tetramethylanthracene?
The InChIKey is OCFNRIXVFFNDKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18/c1-11-5-6-12(2)16-10-18-14(4)8-7-13(3)17(18)9-15(11)16/h5-10H,1-4H3.
What are the key properties of 1,4,5,8-tetramethylanthracene?
1,4,5,8-tetramethylanthracene has a molecular weight of 234.34 g/mol, XLogP of 5.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5,8-tetramethylanthracene is sourced from PubChem (CID 5147927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).