C13H27O3Ti- — CID 5148204
methanol;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium (PubChem CID 5148204) has the molecular formula C13H27O3Ti- and a molecular weight of 279.22 g/mol. Its IUPAC name is methanol;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium.
| Compound Name | methanol;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 5148204 |
| Molecular Formula | C13H27O3Ti- |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | methanol;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium |
| SMILES | CO.CO.CO.Cc1c(C)c(C)[c-](C)c1C.[Ti] |
| InChI | InChI=1S/C10H15.3CH4O.Ti/c1-6-7(2)9(4)10(5)8(6)3;3*1-2;/h1-5H3;3*2H,1H3;/q-1;;;; |
| InChIKey | QVTHEDHVDWHIFR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|