About 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile
2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile (PubChem CID 514836) has the molecular formula C13H6Cl2N2O3
and a molecular weight of 309.11 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile.
Molecular Properties
| Compound Name | 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile |
| PubChem CID | 514836 |
| Molecular Formula | C13H6Cl2N2O3 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl2N2O3/c14-10-2-1-3-12(13(10)15)20-11-5-4-9(17(18)19)6-8(11)7-16/h1-6H |
| InChIKey | CTZJIIVUFUCHOY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile?
The IUPAC name of 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile (CID 514836) is 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile.
What is the SMILES notation for 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile?
The canonical SMILES for 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile is N#Cc1cc([N+](=O)[O-])ccc1Oc1cccc(Cl)c1Cl.
What is the InChIKey of 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile?
The InChIKey is CTZJIIVUFUCHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl2N2O3/c14-10-2-1-3-12(13(10)15)20-11-5-4-9(17(18)19)6-8(11)7-16/h1-6H.
What are the key properties of 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile?
2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile has a molecular weight of 309.11 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichlorophenoxy)-5-nitrobenzonitrile is sourced from PubChem (CID 514836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).