About carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione
carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione (PubChem CID 5148801) has the molecular formula C14H9Co2O8+2
and a molecular weight of 423.08 g/mol. Its IUPAC name is carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione.
Molecular Properties
| Compound Name | carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione |
| PubChem CID | 5148801 |
| Molecular Formula | C14H9Co2O8+2 |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 422.90 |
| IUPAC Name | carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione |
| SMILES | [C-]#CCC(C(C)=O)C(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co+3].[Co] |
| InChI | InChI=1S/C8H9O2.6CO.2Co/c1-4-5-8(6(2)9)7(3)10;6*1-2;;/h8H,5H2,2-3H3;;;;;;;;/q-1;;;;;;;;+3 |
| InChIKey | OTLAPNSQLMRIRF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 153.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione?
The IUPAC name of carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione (CID 5148801) is carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione.
What is the SMILES notation for carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione?
The canonical SMILES for carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione is [C-]#CCC(C(C)=O)C(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co+3].[Co].
What is the InChIKey of carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione?
The InChIKey is OTLAPNSQLMRIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2.6CO.2Co/c1-4-5-8(6(2)9)7(3)10;6*1-2;;/h8H,5H2,2-3H3;;;;;;;;/q-1;;;;;;;;+3.
What are the key properties of carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione?
carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione has a molecular weight of 423.08 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;cobalt;cobalt(3+);3-prop-2-ynylpentane-2,4-dione is sourced from PubChem (CID 5148801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).