About 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine
6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine (PubChem CID 514898) has the molecular formula C14H12BrNO
and a molecular weight of 290.16 g/mol. Its IUPAC name is 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine |
| PubChem CID | 514898 |
| Molecular Formula | C14H12BrNO |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine |
| SMILES | Brc1cnc2c(c1)CCC(c1ccccc1)O2 |
| InChI | InChI=1S/C14H12BrNO/c15-12-8-11-6-7-13(17-14(11)16-9-12)10-4-2-1-3-5-10/h1-5,8-9,13H,6-7H2 |
| InChIKey | QCSIYCMIYWCGDO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
The IUPAC name of 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine (CID 514898) is 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine.
What is the SMILES notation for 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
The canonical SMILES for 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine is Brc1cnc2c(c1)CCC(c1ccccc1)O2.
What is the InChIKey of 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
The InChIKey is QCSIYCMIYWCGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO/c15-12-8-11-6-7-13(17-14(11)16-9-12)10-4-2-1-3-5-10/h1-5,8-9,13H,6-7H2.
What are the key properties of 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine has a molecular weight of 290.16 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-phenyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine is sourced from PubChem (CID 514898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).