C13H29N3 — CID 5149120
N',N'-dimethyl-N-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine (PubChem CID 5149120) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 5149120 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N',N'-dimethyl-N-(1,2,5-trimethylpiperidin-4-yl)propane-1,3-diamine |
| SMILES | CC1CN(C)C(C)CC1NCCCN(C)C |
| InChI | InChI=1S/C13H29N3/c1-11-10-16(5)12(2)9-13(11)14-7-6-8-15(3)4/h11-14H,6-10H2,1-5H3 |
| InChIKey | ZFMHJCHHDNGZAM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|