C25H20Cl2N2O5 — CID 51492062
(3R,3aS,6aS)-5-(3-chlorophenyl)-2-(4-chlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 51492062) has the molecular formula C25H20Cl2N2O5 and a molecular weight of 499.35 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(3-chlorophenyl)-2-(4-chlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-5-(3-chlorophenyl)-2-(4-chlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 51492062 |
| Molecular Formula | C25H20Cl2N2O5 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | (3R,3aS,6aS)-5-(3-chlorophenyl)-2-(4-chlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc([C@H]2[C@@H]3C(=O)N(c4cccc(Cl)c4)C(=O)[C@H]3ON2c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H20Cl2N2O5/c1-32-18-10-11-19(20(13-18)33-2)22-21-23(34-29(22)16-8-6-14(26)7-9-16)25(31)28(24(21)30)17-5-3-4-15(27)12-17/h3-13,21-23H,1-2H3/t21-,22-,23-/m0/s1 |
| InChIKey | YCKZIYVRIPZFNG-VABKMULXSA-N |
| XLogP | 5.06 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|