C19H24N2O2 — CID 51493246
N-[(2-methoxyphenyl)methyl]-1-[(2S)-oxolan-2-yl]-N-(pyridin-3-ylmethyl)methanamine (PubChem CID 51493246) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-1-[(2S)-oxolan-2-yl]-N-(pyridin-3-ylmethyl)methanamine.
| Compound Name | N-[(2-methoxyphenyl)methyl]-1-[(2S)-oxolan-2-yl]-N-(pyridin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 51493246 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-1-[(2S)-oxolan-2-yl]-N-(pyridin-3-ylmethyl)methanamine |
| SMILES | COc1ccccc1CN(Cc1cccnc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H24N2O2/c1-22-19-9-3-2-7-17(19)14-21(15-18-8-5-11-23-18)13-16-6-4-10-20-12-16/h2-4,6-7,9-10,12,18H,5,8,11,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | DHOOCONXZPWIQD-SFHVURJKSA-N |
| XLogP | 3.27 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |