C16H15NO2S3 — CID 51493630
(3aS,6aR)-3a-methyl-3-naphthalen-2-yl-5,5-dioxo-6,6a-dihydro-4H-thieno[3,4-d][1,3]thiazole-2-thione (PubChem CID 51493630) has the molecular formula C16H15NO2S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is (3aS,6aR)-3a-methyl-3-naphthalen-2-yl-5,5-dioxo-6,6a-dihydro-4H-thieno[3,4-d][1,3]thiazole-2-thione.
| Compound Name | (3aS,6aR)-3a-methyl-3-naphthalen-2-yl-5,5-dioxo-6,6a-dihydro-4H-thieno[3,4-d][1,3]thiazole-2-thione |
|---|---|
| PubChem CID | 51493630 |
| Molecular Formula | C16H15NO2S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (3aS,6aR)-3a-methyl-3-naphthalen-2-yl-5,5-dioxo-6,6a-dihydro-4H-thieno[3,4-d][1,3]thiazole-2-thione |
| SMILES | C[C@]12CS(=O)(=O)C[C@@H]1SC(=S)N2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H15NO2S3/c1-16-10-22(18,19)9-14(16)21-15(20)17(16)13-7-6-11-4-2-3-5-12(11)8-13/h2-8,14H,9-10H2,1H3/t14-,16-/m0/s1 |
| InChIKey | RTTMITPPNKPTFY-HOCLYGCPSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|