C20H18F8N6O2 — CID 5149417
1,8-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4,8,11-tetrazacyclotetradecane-5,12-dione (PubChem CID 5149417) has the molecular formula C20H18F8N6O2 and a molecular weight of 526.39 g/mol. Its IUPAC name is 1,8-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4,8,11-tetrazacyclotetradecane-5,12-dione.
| Compound Name | 1,8-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4,8,11-tetrazacyclotetradecane-5,12-dione |
|---|---|
| PubChem CID | 5149417 |
| Molecular Formula | C20H18F8N6O2 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 1,8-bis(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4,8,11-tetrazacyclotetradecane-5,12-dione |
| SMILES | O=C1CCN(c2c(F)c(F)nc(F)c2F)CCNC(=O)CCN(c2c(F)c(F)nc(F)c2F)CCN1 |
| InChI | InChI=1S/C20H18F8N6O2/c21-11-15(12(22)18(26)31-17(11)25)33-5-1-9(35)29-3-8-34(6-2-10(36)30-4-7-33)16-13(23)19(27)32-20(28)14(16)24/h1-8H2,(H,29,35)(H,30,36) |
| InChIKey | NGWLZDJGCYDSIM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|