C56H46N4O4 — CID 5149425
5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22-dihydroporphyrin (PubChem CID 5149425) has the molecular formula C56H46N4O4 and a molecular weight of 839.01 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 5149425 |
| Molecular Formula | C56H46N4O4 |
| Molecular Weight | 839.01 g/mol |
| Exact Mass | 838.35 |
| IUPAC Name | 5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22-dihydroporphyrin |
| SMILES | C=CCOc1ccc(-c2c3nc(c(-c4ccc(OCC=C)cc4)c4ccc([nH]4)c(-c4ccc(OCC=C)cc4)c4ccc([nH]4)c(-c4ccc(OCC=C)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H46N4O4/c1-5-33-61-41-17-9-37(10-18-41)53-45-25-27-47(57-45)54(38-11-19-42(20-12-38)62-34-6-2)49-29-31-51(59-49)56(40-15-23-44(24-16-40)64-36-8-4)52-32-30-50(60-52)55(48-28-26-46(53)58-48)39-13-21-43(22-14-39)63-35-7-3/h5-32,57-58H,1-4,33-36H2/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51-,56-52- |
| InChIKey | GZRMDQBPKLOPQW-YFLSTINXSA-N |
| XLogP | 13.58 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.01 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|