C23H30N6O2 — CID 51494447
3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N-[(4R)-1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]propanamide (PubChem CID 51494447) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N-[(4R)-1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]propanamide.
| Compound Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N-[(4R)-1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]propanamide |
|---|---|
| PubChem CID | 51494447 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N-[(4R)-1-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-4H-indazol-4-yl]propanamide |
| SMILES | COc1ccc(-n2ncc3c2CC(C)(C)C[C@H]3NC(=O)CCn2nc(C)nc2C)cc1 |
| InChI | InChI=1S/C23H30N6O2/c1-15-25-16(2)28(27-15)11-10-22(30)26-20-12-23(3,4)13-21-19(20)14-24-29(21)17-6-8-18(31-5)9-7-17/h6-9,14,20H,10-13H2,1-5H3,(H,26,30)/t20-/m1/s1 |
| InChIKey | RLRWZYNSIJNKIK-HXUWFJFHSA-N |
| XLogP | 3.31 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |