About 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane
2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 5149522) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
Analyze 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
The IUPAC name of 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (CID 5149522) is 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
What is the SMILES notation for 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
The canonical SMILES for 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane is CC12CCCCN1CC1CC2CN2CCCCC12.
What is the InChIKey of 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
The InChIKey is CMKZBDRPQFPVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-16-7-3-5-9-18(16)11-13-10-14(16)12-17-8-4-2-6-15(13)17/h13-15H,2-12H2,1H3.
What are the key properties of 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane has a molecular weight of 248.41 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane is sourced from PubChem (CID 5149522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).