C17H20FN5O2 — CID 51498024
(4S,5S)-N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 51498024) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is (4S,5S)-N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (4S,5S)-N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 51498024 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (4S,5S)-N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)n(CCNC(=O)[C@H]2ON=C(c3ccc(F)cc3)[C@@H]2C)n1 |
| InChI | InChI=1S/C17H20FN5O2/c1-10-15(13-4-6-14(18)7-5-13)22-25-16(10)17(24)19-8-9-23-12(3)20-11(2)21-23/h4-7,10,16H,8-9H2,1-3H3,(H,19,24)/t10-,16-/m0/s1 |
| InChIKey | KLBWSIDIAVXKJU-QFYYESIMSA-N |
| XLogP | 1.59 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |