C19H25N5O — CID 51498035
N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,5,7-trimethyl-1H-indole-2-carboxamide (PubChem CID 51498035) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,5,7-trimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,5,7-trimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 51498035 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,5,7-trimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)NC[C@@H](C)n3nc(C)nc3C)c(C)c2c1 |
| InChI | InChI=1S/C19H25N5O/c1-10-7-11(2)17-16(8-10)13(4)18(22-17)19(25)20-9-12(3)24-15(6)21-14(5)23-24/h7-8,12,22H,9H2,1-6H3,(H,20,25)/t12-/m1/s1 |
| InChIKey | NOILBHMFDHORMR-GFCCVEGCSA-N |
| XLogP | 3.29 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|