C22H25NO4 — CID 51498175
(4S)-N-[1-(4-methoxyphenyl)cyclohexyl]-4H-1,3-benzodioxine-4-carboxamide (PubChem CID 51498175) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (4S)-N-[1-(4-methoxyphenyl)cyclohexyl]-4H-1,3-benzodioxine-4-carboxamide.
| Compound Name | (4S)-N-[1-(4-methoxyphenyl)cyclohexyl]-4H-1,3-benzodioxine-4-carboxamide |
|---|---|
| PubChem CID | 51498175 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (4S)-N-[1-(4-methoxyphenyl)cyclohexyl]-4H-1,3-benzodioxine-4-carboxamide |
| SMILES | COc1ccc(C2(NC(=O)[C@H]3OCOc4ccccc43)CCCCC2)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-25-17-11-9-16(10-12-17)22(13-5-2-6-14-22)23-21(24)20-18-7-3-4-8-19(18)26-15-27-20/h3-4,7-12,20H,2,5-6,13-15H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | CMUPECBPCYYOIA-FQEVSTJZSA-N |
| XLogP | 4.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |