C15H16N4O4S — CID 51498731
(2R)-1-methylsulfonyl-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,5-dihydropyrrole-2-carboxamide (PubChem CID 51498731) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is (2R)-1-methylsulfonyl-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2R)-1-methylsulfonyl-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51498731 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2R)-1-methylsulfonyl-N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2,5-dihydropyrrole-2-carboxamide |
| SMILES | CS(=O)(=O)N1CC=C[C@@H]1C(=O)NCc1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H16N4O4S/c1-24(21,22)19-9-5-8-12(19)14(20)16-10-13-17-15(23-18-13)11-6-3-2-4-7-11/h2-8,12H,9-10H2,1H3,(H,16,20)/t12-/m1/s1 |
| InChIKey | LNMMCCAXZZNURQ-GFCCVEGCSA-N |
| XLogP | 0.55 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|